C24H24FN5OS — CID 3694813
2-cyclohexyl-6-[[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3694813) has the molecular formula C24H24FN5OS and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-cyclohexyl-6-[[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-cyclohexyl-6-[[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3694813 |
| Molecular Formula | C24H24FN5OS |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-cyclohexyl-6-[[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(C)n(-c3cccc(F)c3)c2C)C(=O)N=C2SC(C3CCCCC3)=NN21 |
| InChI | InChI=1S/C24H24FN5OS/c1-14-11-17(15(2)29(14)19-10-6-9-18(25)13-19)12-20-21(26)30-24(27-22(20)31)32-23(28-30)16-7-4-3-5-8-16/h6,9-13,16,26H,3-5,7-8H2,1-2H3/b20-12?,26-21+ |
| InChIKey | MLEJVQZSRKGHRQ-UJHNVWKBSA-N |
| XLogP | 5.43 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|