About methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate
methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate (PubChem CID 3694814) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate |
| PubChem CID | 3694814 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate |
| SMILES | COC(=O)CSc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C9H9N3O2S/c1-14-7(13)5-15-9-11-6-3-2-4-10-8(6)12-9/h2-4H,5H2,1H3,(H,10,11,12) |
| InChIKey | GQWJLPNKEQLIIM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate?
The IUPAC name of methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate (CID 3694814) is methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate.
What is the SMILES notation for methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate?
The canonical SMILES for methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate is COC(=O)CSc1nc2ncccc2[nH]1.
What is the InChIKey of methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate?
The InChIKey is GQWJLPNKEQLIIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-14-7(13)5-15-9-11-6-3-2-4-10-8(6)12-9/h2-4H,5H2,1H3,(H,10,11,12).
What are the key properties of methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate?
methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate has a molecular weight of 223.26 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetate is sourced from PubChem (CID 3694814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).