C24H19BrCl2N2O4 — CID 3695688
[4-bromo-2-[[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-propoxybenzoate (PubChem CID 3695688) has the molecular formula C24H19BrCl2N2O4 and a molecular weight of 550.24 g/mol. Its IUPAC name is [4-bromo-2-[[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-bromo-2-[[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 3695688 |
| Molecular Formula | C24H19BrCl2N2O4 |
| Molecular Weight | 550.24 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | [4-bromo-2-[[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H19BrCl2N2O4/c1-2-11-32-19-7-3-15(4-8-19)24(31)33-22-10-6-18(25)12-17(22)14-28-29-23(30)16-5-9-20(26)21(27)13-16/h3-10,12-14H,2,11H2,1H3,(H,29,30) |
| InChIKey | FSJLLZDXCREWIV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.24 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|