About 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine
4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine (PubChem CID 3695754) has the molecular formula C16H11Cl2N5
and a molecular weight of 344.21 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine |
| PubChem CID | 3695754 |
| Molecular Formula | C16H11Cl2N5 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine |
| SMILES | Nc1ncc(/N=N/c2ccccc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H11Cl2N5/c17-10-6-7-12(13(18)8-10)15-14(9-20-16(19)21-15)23-22-11-4-2-1-3-5-11/h1-9H,(H2,19,20,21)/b23-22+ |
| InChIKey | UNJMNJFPEVJCQK-GHVJWSGMSA-N |
| XLogP | 5.45 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine?
The IUPAC name of 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine (CID 3695754) is 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine?
The canonical SMILES for 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine is Nc1ncc(/N=N/c2ccccc2)c(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine?
The InChIKey is UNJMNJFPEVJCQK-GHVJWSGMSA-N. The full InChI is InChI=1S/C16H11Cl2N5/c17-10-6-7-12(13(18)8-10)15-14(9-20-16(19)21-15)23-22-11-4-2-1-3-5-11/h1-9H,(H2,19,20,21)/b23-22+.
What are the key properties of 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine?
4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine has a molecular weight of 344.21 g/mol, XLogP of 5.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-5-phenyldiazenylpyrimidin-2-amine is sourced from PubChem (CID 3695754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).