About methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate
methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate (PubChem CID 3696742) has the molecular formula C22H20N2O4S
and a molecular weight of 408.48 g/mol. Its IUPAC name is methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate |
| PubChem CID | 3696742 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCSC1=CC(=O)C(Nc2ccc(Nc3ccccc3)cc2)=CC1=O |
| InChI | InChI=1S/C22H20N2O4S/c1-28-22(27)11-12-29-21-14-19(25)18(13-20(21)26)24-17-9-7-16(8-10-17)23-15-5-3-2-4-6-15/h2-10,13-14,23-24H,11-12H2,1H3 |
| InChIKey | JMLYAHJQYCUSEA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate?
The IUPAC name of methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate (CID 3696742) is methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate.
What is the SMILES notation for methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate?
The canonical SMILES for methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate is COC(=O)CCSC1=CC(=O)C(Nc2ccc(Nc3ccccc3)cc2)=CC1=O.
What is the InChIKey of methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate?
The InChIKey is JMLYAHJQYCUSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4S/c1-28-22(27)11-12-29-21-14-19(25)18(13-20(21)26)24-17-9-7-16(8-10-17)23-15-5-3-2-4-6-15/h2-10,13-14,23-24H,11-12H2,1H3.
What are the key properties of methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate?
methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate has a molecular weight of 408.48 g/mol, XLogP of 4.06, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(4-anilinoanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate is sourced from PubChem (CID 3696742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).