About CID 3697243
CID 3697243 (PubChem CID 3697243) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol.
Molecular Properties
| Compound Name | CID 3697243 |
| PubChem CID | 3697243 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | — |
| SMILES | OC1C2(CC2)c2ccccc2C12CC2 |
| InChI | InChI=1S/C13H14O/c14-11-12(5-6-12)9-3-1-2-4-10(9)13(11)7-8-13/h1-4,11,14H,5-8H2 |
| InChIKey | QLJAXEDGKXBWJH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 3697243 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 3697243?
The IUPAC name of CID 3697243 (CID 3697243) is not available.
What is the SMILES notation for CID 3697243?
The canonical SMILES for CID 3697243 is OC1C2(CC2)c2ccccc2C12CC2.
What is the InChIKey of CID 3697243?
The InChIKey is QLJAXEDGKXBWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c14-11-12(5-6-12)9-3-1-2-4-10(9)13(11)7-8-13/h1-4,11,14H,5-8H2.
What are the key properties of CID 3697243?
CID 3697243 has a molecular weight of 186.25 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 3697243 is sourced from PubChem (CID 3697243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).