About 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid
4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 3697332) has the molecular formula C12H19NO5S
and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid |
| PubChem CID | 3697332 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | CCC(C)N(C(=O)C=CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19NO5S/c1-3-9(2)13(11(14)4-5-12(15)16)10-6-7-19(17,18)8-10/h4-5,9-10H,3,6-8H2,1-2H3,(H,15,16) |
| InChIKey | ZPMVAQPWYFMVID-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The IUPAC name of 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid (CID 3697332) is 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The canonical SMILES for 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid is CCC(C)N(C(=O)C=CC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The InChIKey is ZPMVAQPWYFMVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5S/c1-3-9(2)13(11(14)4-5-12(15)16)10-6-7-19(17,18)8-10/h4-5,9-10H,3,6-8H2,1-2H3,(H,15,16).
What are the key properties of 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid has a molecular weight of 289.35 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 3697332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).