About 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 3697667) has the molecular formula C18H16N2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 3697667 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | c1ccc(-c2ccc(-c3cn4c(n3)CCC4)cc2)cc1 |
| InChI | InChI=1S/C18H16N2/c1-2-5-14(6-3-1)15-8-10-16(11-9-15)17-13-20-12-4-7-18(20)19-17/h1-3,5-6,8-11,13H,4,7,12H2 |
| InChIKey | IMYNUXAXHXLXJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 3697667) is 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is c1ccc(-c2ccc(-c3cn4c(n3)CCC4)cc2)cc1.
What is the InChIKey of 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is IMYNUXAXHXLXJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2/c1-2-5-14(6-3-1)15-8-10-16(11-9-15)17-13-20-12-4-7-18(20)19-17/h1-3,5-6,8-11,13H,4,7,12H2.
What are the key properties of 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 260.34 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 3697667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).