About [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea
[(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea (PubChem CID 3697719) has the molecular formula C10H19N3S2
and a molecular weight of 245.42 g/mol. Its IUPAC name is [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea |
| PubChem CID | 3697719 |
| Molecular Formula | C10H19N3S2 |
| Molecular Weight | 245.42 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea |
| SMILES | CCC1SC(C)CC(=NNC(N)=S)C1C |
| InChI | InChI=1S/C10H19N3S2/c1-4-9-7(3)8(5-6(2)15-9)12-13-10(11)14/h6-7,9H,4-5H2,1-3H3,(H3,11,13,14) |
| InChIKey | UAUHIFSBKYNFHU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea?
The IUPAC name of [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea (CID 3697719) is [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea.
What is the SMILES notation for [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea?
The canonical SMILES for [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea is CCC1SC(C)CC(=NNC(N)=S)C1C.
What is the InChIKey of [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea?
The InChIKey is UAUHIFSBKYNFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3S2/c1-4-9-7(3)8(5-6(2)15-9)12-13-10(11)14/h6-7,9H,4-5H2,1-3H3,(H3,11,13,14).
What are the key properties of [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea?
[(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea has a molecular weight of 245.42 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-ethyl-3,6-dimethylthian-4-ylidene)amino]thiourea is sourced from PubChem (CID 3697719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).