About (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate
(2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate (PubChem CID 3697950) has the molecular formula C15H12F3NO2
and a molecular weight of 295.26 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate |
| PubChem CID | 3697950 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO2/c16-15(17,18)13(11-7-3-1-4-8-11)21-14(20)19-12-9-5-2-6-10-12/h1-10,13H,(H,19,20) |
| InChIKey | KXLYRPXGMALCIH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate?
The IUPAC name of (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate (CID 3697950) is (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate.
What is the SMILES notation for (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate?
The canonical SMILES for (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate is O=C(Nc1ccccc1)OC(c1ccccc1)C(F)(F)F.
What is the InChIKey of (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate?
The InChIKey is KXLYRPXGMALCIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3NO2/c16-15(17,18)13(11-7-3-1-4-8-11)21-14(20)19-12-9-5-2-6-10-12/h1-10,13H,(H,19,20).
What are the key properties of (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate?
(2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate has a molecular weight of 295.26 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoro-1-phenylethyl) N-phenylcarbamate is sourced from PubChem (CID 3697950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).