C24H19N5O3S — CID 36983442
4-(2,3-dimethylphenyl)-1-[(4-nitrophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 36983442) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-1-[(4-nitrophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(2,3-dimethylphenyl)-1-[(4-nitrophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 36983442 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-1-[(4-nitrophenyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1cccc(-n2c(=O)c3ccccc3n3c(SCc4ccc([N+](=O)[O-])cc4)nnc23)c1C |
| InChI | InChI=1S/C24H19N5O3S/c1-15-6-5-9-20(16(15)2)27-22(30)19-7-3-4-8-21(19)28-23(27)25-26-24(28)33-14-17-10-12-18(13-11-17)29(31)32/h3-13H,14H2,1-2H3 |
| InChIKey | DCMZKCNGYVVHSD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|