C23H15Cl2N3O — CID 3698395
2,3-bis(3-chlorophenyl)-1,2-dihydropyrimido[4,5-b]quinolin-4-one (PubChem CID 3698395) has the molecular formula C23H15Cl2N3O and a molecular weight of 420.30 g/mol. Its IUPAC name is 2,3-bis(3-chlorophenyl)-1,2-dihydropyrimido[4,5-b]quinolin-4-one.
| Compound Name | 2,3-bis(3-chlorophenyl)-1,2-dihydropyrimido[4,5-b]quinolin-4-one |
|---|---|
| PubChem CID | 3698395 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2,3-bis(3-chlorophenyl)-1,2-dihydropyrimido[4,5-b]quinolin-4-one |
| SMILES | O=C1c2cc3ccccc3nc2NC(c2cccc(Cl)c2)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Cl2N3O/c24-16-7-3-6-15(11-16)22-27-21-19(12-14-5-1-2-10-20(14)26-21)23(29)28(22)18-9-4-8-17(25)13-18/h1-13,22H,(H,26,27) |
| InChIKey | DBTZIMBSAJRZBI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |