C20H27NO2 — CID 3698531
2-[1-[[2-(furan-2-ylmethyl)cyclopentyl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one (PubChem CID 3698531) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-[1-[[2-(furan-2-ylmethyl)cyclopentyl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one.
| Compound Name | 2-[1-[[2-(furan-2-ylmethyl)cyclopentyl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 3698531 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-[1-[[2-(furan-2-ylmethyl)cyclopentyl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
| SMILES | CC(NC1CCCC1Cc1ccco1)=C1C(=O)CC2C1C2(C)C |
| InChI | InChI=1S/C20H27NO2/c1-12(18-17(22)11-15-19(18)20(15,2)3)21-16-8-4-6-13(16)10-14-7-5-9-23-14/h5,7,9,13,15-16,19,21H,4,6,8,10-11H2,1-3H3 |
| InChIKey | OUDJFFXQVMRUTG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|