C15H15BrN2O2S2 — CID 36988394
2-(2-bromophenyl)sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 36988394) has the molecular formula C15H15BrN2O2S2 and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(2-bromophenyl)sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 36988394 |
| Molecular Formula | C15H15BrN2O2S2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | O=C(CSc1ccccc1Br)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H15BrN2O2S2/c16-12-5-1-2-6-13(12)22-10-14(19)18-15(20)17-8-7-11-4-3-9-21-11/h1-6,9H,7-8,10H2,(H2,17,18,19,20) |
| InChIKey | ARFOJMCFCOKAHE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |