C17H17F3N2O2S — CID 3698955
1-(2,6-difluorophenyl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine (PubChem CID 3698955) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine.
| Compound Name | 1-(2,6-difluorophenyl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3698955 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H17F3N2O2S/c18-14-6-4-13(5-7-14)12-21-8-10-22(11-9-21)25(23,24)17-15(19)2-1-3-16(17)20/h1-7H,8-12H2 |
| InChIKey | IQCWOYRSKXNMPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |