C22H27ClN2O — CID 36996
2-Indolinone, 1-benzyl-3-methyl-3-piperidinomethyl-, monohydrochloride (PubChem CID 36996) has the molecular formula C22H27ClN2O and a molecular weight of 370.90 g/mol. Its IUPAC name is 1-benzyl-3-methyl-3-(piperidin-1-ium-1-ylmethyl)indol-2-one chloride.
| Compound Name | 2-Indolinone, 1-benzyl-3-methyl-3-piperidinomethyl-, monohydrochloride |
|---|---|
| PubChem CID | 36996 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-benzyl-3-methyl-3-(piperidin-1-ium-1-ylmethyl)indol-2-one chloride |
| SMILES | CC1(C2=CC=CC=C2N(C1=O)CC3=CC=CC=C3)C[NH+]4CCCCC4.[Cl-] |
| InChIKey | ZVAXSEAMVSGYCP-UHFFFAOYSA-N |
| XLogP | N/A |
| TPSA | 24.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 467 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |