About benzyl N-cyano-N'-propan-2-ylcarbamimidothioate
benzyl N-cyano-N'-propan-2-ylcarbamimidothioate (PubChem CID 3700772) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is benzyl N-cyano-N'-propan-2-ylcarbamimidothioate.
Molecular Properties
| Compound Name | benzyl N-cyano-N'-propan-2-ylcarbamimidothioate |
| PubChem CID | 3700772 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | benzyl N-cyano-N'-propan-2-ylcarbamimidothioate |
| SMILES | CC(C)/N=C(\NC#N)SCc1ccccc1 |
| InChI | InChI=1S/C12H15N3S/c1-10(2)15-12(14-9-13)16-8-11-6-4-3-5-7-11/h3-7,10H,8H2,1-2H3,(H,14,15) |
| InChIKey | GKNAZBKFCXFIFZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-cyano-N'-propan-2-ylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-cyano-N'-propan-2-ylcarbamimidothioate?
The IUPAC name of benzyl N-cyano-N'-propan-2-ylcarbamimidothioate (CID 3700772) is benzyl N-cyano-N'-propan-2-ylcarbamimidothioate.
What is the SMILES notation for benzyl N-cyano-N'-propan-2-ylcarbamimidothioate?
The canonical SMILES for benzyl N-cyano-N'-propan-2-ylcarbamimidothioate is CC(C)/N=C(\NC#N)SCc1ccccc1.
What is the InChIKey of benzyl N-cyano-N'-propan-2-ylcarbamimidothioate?
The InChIKey is GKNAZBKFCXFIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-10(2)15-12(14-9-13)16-8-11-6-4-3-5-7-11/h3-7,10H,8H2,1-2H3,(H,14,15).
What are the key properties of benzyl N-cyano-N'-propan-2-ylcarbamimidothioate?
benzyl N-cyano-N'-propan-2-ylcarbamimidothioate has a molecular weight of 233.34 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-cyano-N'-propan-2-ylcarbamimidothioate is sourced from PubChem (CID 3700772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).