About N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide (PubChem CID 37015453) has the molecular formula C18H14N4O2S
and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide |
| PubChem CID | 37015453 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cnn(-c4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C18H14N4O2S/c23-17-11-25-16-7-6-13(8-15(16)21-17)20-18(24)12-9-19-22(10-12)14-4-2-1-3-5-14/h1-10H,11H2,(H,20,24)(H,21,23) |
| InChIKey | PXVLFXBSPPGTCP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide?
The IUPAC name of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide (CID 37015453) is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide.
What is the SMILES notation for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide?
The canonical SMILES for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide is O=C1CSc2ccc(NC(=O)c3cnn(-c4ccccc4)c3)cc2N1.
What is the InChIKey of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide?
The InChIKey is PXVLFXBSPPGTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O2S/c23-17-11-25-16-7-6-13(8-15(16)21-17)20-18(24)12-9-19-22(10-12)14-4-2-1-3-5-14/h1-10H,11H2,(H,20,24)(H,21,23).
What are the key properties of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide?
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide has a molecular weight of 350.40 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1-phenylpyrazole-4-carboxamide is sourced from PubChem (CID 37015453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).