About N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide (PubChem CID 37015518) has the molecular formula C20H18N4O2S
and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide.
Molecular Properties
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide |
| PubChem CID | 37015518 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C20H18N4O2S/c25-19(22-15-7-8-18-17(10-15)23-20(26)13-27-18)9-6-14-11-21-24(12-14)16-4-2-1-3-5-16/h1-5,7-8,10-12H,6,9,13H2,(H,22,25)(H,23,26) |
| InChIKey | KQSQBNTXIPJVMY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide?
The IUPAC name of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide (CID 37015518) is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide.
What is the SMILES notation for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide?
The canonical SMILES for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide is O=C(CCc1cnn(-c2ccccc2)c1)Nc1ccc2c(c1)NC(=O)CS2.
What is the InChIKey of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide?
The InChIKey is KQSQBNTXIPJVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2S/c25-19(22-15-7-8-18-17(10-15)23-20(26)13-27-18)9-6-14-11-21-24(12-14)16-4-2-1-3-5-16/h1-5,7-8,10-12H,6,9,13H2,(H,22,25)(H,23,26).
What are the key properties of N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide?
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide has a molecular weight of 378.46 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(1-phenylpyrazol-4-yl)propanamide is sourced from PubChem (CID 37015518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).