C12H7BrCl2FNO2S — CID 3701608
N-(2-bromo-4-fluorophenyl)-2,5-dichlorobenzenesulfonamide (PubChem CID 3701608) has the molecular formula C12H7BrCl2FNO2S and a molecular weight of 399.07 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3701608 |
| Molecular Formula | C12H7BrCl2FNO2S |
| Molecular Weight | 399.07 g/mol |
| Exact Mass | 396.87 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-2,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1Br)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7BrCl2FNO2S/c13-9-6-8(16)2-4-11(9)17-20(18,19)12-5-7(14)1-3-10(12)15/h1-6,17H |
| InChIKey | SPFGSCCGFUWNKB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.07 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |