About 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide
3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 3701664) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 3701664 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=CC(N2CC2)C1 |
| InChI | InChI=1S/C6H9NO2S/c8-10(9)4-1-6(5-10)7-2-3-7/h1,4,6H,2-3,5H2 |
| InChIKey | MSFOGTTYGAOWGI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (CID 3701664) is 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is O=S1(=O)C=CC(N2CC2)C1.
What is the InChIKey of 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is MSFOGTTYGAOWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c8-10(9)4-1-6(5-10)7-2-3-7/h1,4,6H,2-3,5H2.
What are the key properties of 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 159.21 g/mol, XLogP of -0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aziridin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 3701664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).