C14H18N4O3S — CID 37018591
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 37018591) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 37018591 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)CN2C(=O)NC3(CCCCC3)C2=O)s1 |
| InChI | InChI=1S/C14H18N4O3S/c1-9-7-15-12(22-9)16-10(19)8-18-11(20)14(17-13(18)21)5-3-2-4-6-14/h7H,2-6,8H2,1H3,(H,17,21)(H,15,16,19) |
| InChIKey | URVHVZMMFKDQCY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|