C22H21N3O3 — CID 37020487
(4-acetamidophenyl) 1-(4-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (PubChem CID 37020487) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (4-acetamidophenyl) 1-(4-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | (4-acetamidophenyl) 1-(4-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 37020487 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4-acetamidophenyl) 1-(4-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2nn(-c3ccc(C)cc3)c3c2CCC3)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-14-6-10-17(11-7-14)25-20-5-3-4-19(20)21(24-25)22(27)28-18-12-8-16(9-13-18)23-15(2)26/h6-13H,3-5H2,1-2H3,(H,23,26) |
| InChIKey | PTPDZFZFYNNIQW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|