C12H10F13NO2 — CID 3702492
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(oxolan-2-ylmethyl)heptanamide (PubChem CID 3702492) has the molecular formula C12H10F13NO2 and a molecular weight of 447.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(oxolan-2-ylmethyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(oxolan-2-ylmethyl)heptanamide |
|---|---|
| PubChem CID | 3702492 |
| Molecular Formula | C12H10F13NO2 |
| Molecular Weight | 447.19 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(oxolan-2-ylmethyl)heptanamide |
| SMILES | O=C(NCC1CCCO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F13NO2/c13-7(14,6(27)26-4-5-2-1-3-28-5)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h5H,1-4H2,(H,26,27) |
| InChIKey | FFUVIYTYLQOHTL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|