C21H22FN3O4S — CID 37029500
N-[2-(cyclopropylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 37029500) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[2-(cyclopropylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(cyclopropylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 37029500 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[2-(cyclopropylcarbamoyl)phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CC1)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H22FN3O4S/c22-17-10-7-14(13-19(17)30(28,29)25-11-3-4-12-25)20(26)24-18-6-2-1-5-16(18)21(27)23-15-8-9-15/h1-2,5-7,10,13,15H,3-4,8-9,11-12H2,(H,23,27)(H,24,26) |
| InChIKey | VMKQNMBQFRWPFE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |