C9H11N5O3 — CID 37029884
N-[(4S,5S)-9-acetyl-6-oxo-4,5-dihydro-1H-purin-2-yl]acetamide (PubChem CID 37029884) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is N-[(4S,5S)-9-acetyl-6-oxo-4,5-dihydro-1H-purin-2-yl]acetamide.
| Compound Name | N-[(4S,5S)-9-acetyl-6-oxo-4,5-dihydro-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 37029884 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-[(4S,5S)-9-acetyl-6-oxo-4,5-dihydro-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)NC1=N[C@@H]2[C@H](N=CN2C(C)=O)C(=O)N1 |
| InChI | InChI=1S/C9H11N5O3/c1-4(15)11-9-12-7-6(8(17)13-9)10-3-14(7)5(2)16/h3,6-7H,1-2H3,(H2,11,12,13,15,17)/t6-,7-/m0/s1 |
| InChIKey | OYSJMAILDVSKQJ-BQBZGAKWSA-N |
| XLogP | -1.81 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |