C7H8N2S2 — CID 3704003
1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dithione (PubChem CID 3704003) has the molecular formula C7H8N2S2 and a molecular weight of 184.29 g/mol. Its IUPAC name is 1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dithione.
| Compound Name | 1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 3704003 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dithione |
| SMILES | S=c1[nH]c2c(c(=S)[nH]1)CCC2 |
| InChI | InChI=1S/C7H8N2S2/c10-6-4-2-1-3-5(4)8-7(11)9-6/h1-3H2,(H2,8,9,10,11) |
| InChIKey | UEKZKPGUTCCSFX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|