About 3,7-dimethyloct-6-enamide
3,7-dimethyloct-6-enamide (PubChem CID 3704098) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enamide.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enamide |
| PubChem CID | 3704098 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,7-dimethyloct-6-enamide |
| SMILES | CC(C)=CCCC(C)CC(N)=O |
| InChI | InChI=1S/C10H19NO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H2,11,12) |
| InChIKey | PUGXASHPRMOMNU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enamide?
The IUPAC name of 3,7-dimethyloct-6-enamide (CID 3704098) is 3,7-dimethyloct-6-enamide.
What is the SMILES notation for 3,7-dimethyloct-6-enamide?
The canonical SMILES for 3,7-dimethyloct-6-enamide is CC(C)=CCCC(C)CC(N)=O.
What is the InChIKey of 3,7-dimethyloct-6-enamide?
The InChIKey is PUGXASHPRMOMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H2,11,12).
What are the key properties of 3,7-dimethyloct-6-enamide?
3,7-dimethyloct-6-enamide has a molecular weight of 169.27 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enamide is sourced from PubChem (CID 3704098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).