C29H30NO6+ — CID 3704138
8-(3,4-dimethoxyphenyl)-2,3,10,11-tetramethoxy-8,13-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 3704138) has the molecular formula C29H30NO6+ and a molecular weight of 488.56 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-2,3,10,11-tetramethoxy-8,13-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 8-(3,4-dimethoxyphenyl)-2,3,10,11-tetramethoxy-8,13-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 3704138 |
| Molecular Formula | C29H30NO6+ |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-2,3,10,11-tetramethoxy-8,13-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3Cc3c4cc(OC)c(OC)cc4cc[n+]32)cc1OC |
| InChI | InChI=1S/C29H30NO6/c1-31-23-8-7-18(13-24(23)32-2)29-21-16-28(36-6)26(34-4)14-19(21)11-22-20-15-27(35-5)25(33-3)12-17(20)9-10-30(22)29/h7-10,12-16,29H,11H2,1-6H3/q+1 |
| InChIKey | WKHCHIYLQUHSSM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|