C22H25ClN4O3 — CID 37043497
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide (PubChem CID 37043497) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 37043497 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CN3C(=O)COc4ccc(Cl)cc43)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-2-25-9-11-26(12-10-25)18-6-4-17(5-7-18)24-21(28)14-27-19-13-16(23)3-8-20(19)30-15-22(27)29/h3-8,13H,2,9-12,14-15H2,1H3,(H,24,28) |
| InChIKey | BTPCKBMTYMKUDK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|