C27H36N6O5S — CID 3704565
N-[2-[[4-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-N-propan-2-ylcyclohexanecarboxamide (PubChem CID 3704565) has the molecular formula C27H36N6O5S and a molecular weight of 556.69 g/mol. Its IUPAC name is N-[2-[[4-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-N-propan-2-ylcyclohexanecarboxamide.
| Compound Name | N-[2-[[4-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-N-propan-2-ylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 3704565 |
| Molecular Formula | C27H36N6O5S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[2-[[4-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-N-propan-2-ylcyclohexanecarboxamide |
| SMILES | CC(C)N(CC(=O)Nc1nc(CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cs1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H36N6O5S/c1-19(2)32(26(36)20-6-4-3-5-7-20)17-24(34)29-27-28-21(18-39-27)16-25(35)31-14-12-30(13-15-31)22-8-10-23(11-9-22)33(37)38/h8-11,18-20H,3-7,12-17H2,1-2H3,(H,28,29,34) |
| InChIKey | YQWUZWBBIXUDOJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|