C14H18O2 — CID 3704951
2,3,8,9-tetramethyldeca-1,9-dien-4,6-diyne-3,8-diol (PubChem CID 3704951) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,3,8,9-tetramethyldeca-1,9-dien-4,6-diyne-3,8-diol.
| Compound Name | 2,3,8,9-tetramethyldeca-1,9-dien-4,6-diyne-3,8-diol |
|---|---|
| PubChem CID | 3704951 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,3,8,9-tetramethyldeca-1,9-dien-4,6-diyne-3,8-diol |
| SMILES | C=C(C)C(C)(O)C#CC#CC(C)(O)C(=C)C |
| InChI | InChI=1S/C14H18O2/c1-11(2)13(5,15)9-7-8-10-14(6,16)12(3)4/h15-16H,1,3H2,2,4-6H3 |
| InChIKey | JUVSIRBVIVBQIZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|