About 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline
5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 3705005) has the molecular formula C12H9Br2N
and a molecular weight of 327.02 g/mol. Its IUPAC name is 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline.
Molecular Properties
| Compound Name | 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline |
| PubChem CID | 3705005 |
| Molecular Formula | C12H9Br2N |
| Molecular Weight | 327.02 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | Brc1cc(Br)c2nc3c(cc2c1)CCC3 |
| InChI | InChI=1S/C12H9Br2N/c13-9-5-8-4-7-2-1-3-11(7)15-12(8)10(14)6-9/h4-6H,1-3H2 |
| InChIKey | DAHMUJBHSOWVNQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline?
The IUPAC name of 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline (CID 3705005) is 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline.
What is the SMILES notation for 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline?
The canonical SMILES for 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline is Brc1cc(Br)c2nc3c(cc2c1)CCC3.
What is the InChIKey of 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline?
The InChIKey is DAHMUJBHSOWVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br2N/c13-9-5-8-4-7-2-1-3-11(7)15-12(8)10(14)6-9/h4-6H,1-3H2.
What are the key properties of 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline?
5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline has a molecular weight of 327.02 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromo-2,3-dihydro-1H-cyclopenta[b]quinoline is sourced from PubChem (CID 3705005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).