C20H22ClN3O4 — CID 37051019
N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-nitrophenyl)acetamide (PubChem CID 37051019) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 37051019 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NC[C@H](c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C20H22ClN3O4/c21-17-7-3-2-6-16(17)19(23-9-11-28-12-10-23)14-22-20(25)13-15-5-1-4-8-18(15)24(26)27/h1-8,19H,9-14H2,(H,22,25)/t19-/m1/s1 |
| InChIKey | HCFWORHUXRLLOT-LJQANCHMSA-N |
| XLogP | 2.98 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|