About (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium
(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium (PubChem CID 3705222) has the molecular formula C10H18NO+
and a molecular weight of 168.26 g/mol. Its IUPAC name is (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium.
Molecular Properties
| Compound Name | (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
| PubChem CID | 3705222 |
| Molecular Formula | C10H18NO+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
| SMILES | CCOC1=CC(=[NH2+])CC(C)(C)C1 |
| InChI | InChI=1S/C10H17NO/c1-4-12-9-5-8(11)6-10(2,3)7-9/h5,11H,4,6-7H2,1-3H3/p+1 |
| InChIKey | SEQJHGPDUXYADM-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The IUPAC name of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium (CID 3705222) is (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium.
What is the SMILES notation for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The canonical SMILES for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium is CCOC1=CC(=[NH2+])CC(C)(C)C1.
What is the InChIKey of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The InChIKey is SEQJHGPDUXYADM-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H17NO/c1-4-12-9-5-8(11)6-10(2,3)7-9/h5,11H,4,6-7H2,1-3H3/p+1.
What are the key properties of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium has a molecular weight of 168.26 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium is sourced from PubChem (CID 3705222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).