About N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine
N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 3705369) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 3705369 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC(C)CCCCNC1=NCCS1 |
| InChI | InChI=1S/C11H22N2S/c1-3-10(2)6-4-5-7-12-11-13-8-9-14-11/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | USSUVJMMDUZVBR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine (CID 3705369) is N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine is CCC(C)CCCCNC1=NCCS1.
What is the InChIKey of N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is USSUVJMMDUZVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-3-10(2)6-4-5-7-12-11-13-8-9-14-11/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine?
N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 214.38 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methylheptyl)-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 3705369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).