C18H15BrO4 — CID 3705738
4-[(4-bromophenyl)methylidene]-6,7-dimethoxy-1H-isochromen-3-one (PubChem CID 3705738) has the molecular formula C18H15BrO4 and a molecular weight of 375.22 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methylidene]-6,7-dimethoxy-1H-isochromen-3-one.
| Compound Name | 4-[(4-bromophenyl)methylidene]-6,7-dimethoxy-1H-isochromen-3-one |
|---|---|
| PubChem CID | 3705738 |
| Molecular Formula | C18H15BrO4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 4-[(4-bromophenyl)methylidene]-6,7-dimethoxy-1H-isochromen-3-one |
| SMILES | COc1cc2c(cc1OC)C(=Cc1ccc(Br)cc1)C(=O)OC2 |
| InChI | InChI=1S/C18H15BrO4/c1-21-16-8-12-10-23-18(20)15(14(12)9-17(16)22-2)7-11-3-5-13(19)6-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | MXFIQQQOZRFJGZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|