C23H20N4OS — CID 3705781
11-benzyl-10-(2-benzylidenehydrazinyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 3705781) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 11-benzyl-10-(2-benzylidenehydrazinyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 11-benzyl-10-(2-benzylidenehydrazinyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 3705781 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 11-benzyl-10-(2-benzylidenehydrazinyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=c1c2c3c(sc2nc(NN=Cc2ccccc2)n1Cc1ccccc1)CCC3 |
| InChI | InChI=1S/C23H20N4OS/c28-22-20-18-12-7-13-19(18)29-21(20)25-23(26-24-14-16-8-3-1-4-9-16)27(22)15-17-10-5-2-6-11-17/h1-6,8-11,14H,7,12-13,15H2,(H,25,26) |
| InChIKey | OMDCGIBMDUOHHD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|