About 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide
4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide (PubChem CID 3705807) has the molecular formula C23H25N3O2S
and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide.
Molecular Properties
| Compound Name | 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide |
| PubChem CID | 3705807 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(Sc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-4-5-14-28-20-10-6-18(7-11-20)22(27)26-19-8-12-21(13-9-19)29-23-24-16(2)15-17(3)25-23/h6-13,15H,4-5,14H2,1-3H3,(H,26,27) |
| InChIKey | UEADSHVLVUUQTQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide?
The IUPAC name of 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide (CID 3705807) is 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide.
What is the SMILES notation for 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide?
The canonical SMILES for 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide is CCCCOc1ccc(C(=O)Nc2ccc(Sc3nc(C)cc(C)n3)cc2)cc1.
What is the InChIKey of 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide?
The InChIKey is UEADSHVLVUUQTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2S/c1-4-5-14-28-20-10-6-18(7-11-20)22(27)26-19-8-12-21(13-9-19)29-23-24-16(2)15-17(3)25-23/h6-13,15H,4-5,14H2,1-3H3,(H,26,27).
What are the key properties of 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide?
4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide has a molecular weight of 407.54 g/mol, XLogP of 5.68, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide is sourced from PubChem (CID 3705807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).