C18H12N4O3S2 — CID 3706030
2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 3706030) has the molecular formula C18H12N4O3S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3706030 |
| Molecular Formula | C18H12N4O3S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | N#Cc1ccc(-c2cccs2)nc1SCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12N4O3S2/c19-10-12-3-8-15(16-2-1-9-26-16)21-18(12)27-11-17(23)20-13-4-6-14(7-5-13)22(24)25/h1-9H,11H2,(H,20,23) |
| InChIKey | AWKXCKJLIMFNCA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|