About N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide
N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 3706450) has the molecular formula C18H15N3O4
and a molecular weight of 337.34 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| PubChem CID | 3706450 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)C2COc3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C18H15N3O4/c1-21-12-7-3-2-6-11(12)16(18(21)23)19-20-17(22)15-10-24-13-8-4-5-9-14(13)25-15/h2-9,15,23H,10H2,1H3/b20-19+ |
| InChIKey | GAXICPNENSDXRJ-FMQUCBEESA-N |
| XLogP | 3.33 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The IUPAC name of N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide (CID 3706450) is N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
What is the SMILES notation for N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The canonical SMILES for N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide is Cn1c(O)c(/N=N/C(=O)C2COc3ccccc3O2)c2ccccc21.
What is the InChIKey of N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The InChIKey is GAXICPNENSDXRJ-FMQUCBEESA-N. The full InChI is InChI=1S/C18H15N3O4/c1-21-12-7-3-2-6-11(12)16(18(21)23)19-20-17(22)15-10-24-13-8-4-5-9-14(13)25-15/h2-9,15,23H,10H2,1H3/b20-19+.
What are the key properties of N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide has a molecular weight of 337.34 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-1-methylindol-3-yl)imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide is sourced from PubChem (CID 3706450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).