C17H24N2O3S2 — CID 3706715
ethyl 5-ethyl-5-methyl-2-(prop-2-enylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate (PubChem CID 3706715) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl 5-ethyl-5-methyl-2-(prop-2-enylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate.
| Compound Name | ethyl 5-ethyl-5-methyl-2-(prop-2-enylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 3706715 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 5-ethyl-5-methyl-2-(prop-2-enylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]pyran-3-carboxylate |
| SMILES | C=CCNC(=S)Nc1sc2c(c1C(=O)OCC)CC(C)(CC)OC2 |
| InChI | InChI=1S/C17H24N2O3S2/c1-5-8-18-16(23)19-14-13(15(20)21-7-3)11-9-17(4,6-2)22-10-12(11)24-14/h5H,1,6-10H2,2-4H3,(H2,18,19,23) |
| InChIKey | ZNWWFVSDWQOFOT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|