C26H21ClN4O2 — CID 37068160
(4-chlorophenyl)-[4-(2-pyridin-4-ylquinoline-4-carbonyl)piperazin-1-yl]methanone (PubChem CID 37068160) has the molecular formula C26H21ClN4O2 and a molecular weight of 456.93 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(2-pyridin-4-ylquinoline-4-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-(2-pyridin-4-ylquinoline-4-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 37068160 |
| Molecular Formula | C26H21ClN4O2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (4-chlorophenyl)-[4-(2-pyridin-4-ylquinoline-4-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN(C(=O)c2cc(-c3ccncc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H21ClN4O2/c27-20-7-5-19(6-8-20)25(32)30-13-15-31(16-14-30)26(33)22-17-24(18-9-11-28-12-10-18)29-23-4-2-1-3-21(22)23/h1-12,17H,13-16H2 |
| InChIKey | GRMGIAUWVMHRPS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |