C16H21N3O2S — CID 3706946
ethyl 2-(prop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 3706946) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 2-(prop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(prop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3706946 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 2-(prop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | C=CCNC(=S)Nc1nc2c(cc1C(=O)OCC)CCCC2 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-9-17-16(22)19-14-12(15(20)21-4-2)10-11-7-5-6-8-13(11)18-14/h3,10H,1,4-9H2,2H3,(H2,17,18,19,22) |
| InChIKey | BZMMSFAELRGINY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|