C27H24N6O4 — CID 3707051
[2-ethoxy-4-[5-methyl-6-(phenylcarbamoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]phenyl] benzoate (PubChem CID 3707051) has the molecular formula C27H24N6O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is [2-ethoxy-4-[5-methyl-6-(phenylcarbamoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]phenyl] benzoate.
| Compound Name | [2-ethoxy-4-[5-methyl-6-(phenylcarbamoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 3707051 |
| Molecular Formula | C27H24N6O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [2-ethoxy-4-[5-methyl-6-(phenylcarbamoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]phenyl] benzoate |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nnnn32)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24N6O4/c1-3-36-22-16-19(14-15-21(22)37-26(35)18-10-6-4-7-11-18)24-23(17(2)28-27-30-31-32-33(24)27)25(34)29-20-12-8-5-9-13-20/h4-16,24H,3H2,1-2H3,(H,29,34)(H,28,30,32) |
| InChIKey | YBORPUNFQPQHJG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|