C19H26ClN3O2 — CID 37071019
(4R)-4-[4-(2-chlorophenyl)piperazine-1-carbonyl]-1-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 37071019) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is (4R)-4-[4-(2-chlorophenyl)piperazine-1-carbonyl]-1-(2-methylpropyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[4-(2-chlorophenyl)piperazine-1-carbonyl]-1-(2-methylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 37071019 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (4R)-4-[4-(2-chlorophenyl)piperazine-1-carbonyl]-1-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | CC(C)CN1C[C@H](C(=O)N2CCN(c3ccccc3Cl)CC2)CC1=O |
| InChI | InChI=1S/C19H26ClN3O2/c1-14(2)12-23-13-15(11-18(23)24)19(25)22-9-7-21(8-10-22)17-6-4-3-5-16(17)20/h3-6,14-15H,7-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | JGBYMFISRLNGAY-OAHLLOKOSA-N |
| XLogP | 2.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |