C23H29N4O4+ — CID 3707504
N-[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 3707504) has the molecular formula C23H29N4O4+ and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 3707504 |
| Molecular Formula | C23H29N4O4+ |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | COc1ccc(N2CC[NH+](CCNC(=O)CN3C(=O)COc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-30-19-8-6-18(7-9-19)26-14-12-25(13-15-26)11-10-24-22(28)16-27-20-4-2-3-5-21(20)31-17-23(27)29/h2-9H,10-17H2,1H3,(H,24,28)/p+1 |
| InChIKey | ZXBUYKZWAGJYLG-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|