About 2-(benzenesulfonyl)oxane
2-(benzenesulfonyl)oxane (PubChem CID 3707989) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(benzenesulfonyl)oxane.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)oxane |
| PubChem CID | 3707989 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(benzenesulfonyl)oxane |
| SMILES | O=S(=O)(c1ccccc1)C1CCCCO1 |
| InChI | InChI=1S/C11H14O3S/c12-15(13,10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | ZWVRLRYLOVJRIO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)oxane?
The IUPAC name of 2-(benzenesulfonyl)oxane (CID 3707989) is 2-(benzenesulfonyl)oxane.
What is the SMILES notation for 2-(benzenesulfonyl)oxane?
The canonical SMILES for 2-(benzenesulfonyl)oxane is O=S(=O)(c1ccccc1)C1CCCCO1.
What is the InChIKey of 2-(benzenesulfonyl)oxane?
The InChIKey is ZWVRLRYLOVJRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c12-15(13,10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-3,6-7,11H,4-5,8-9H2.
What are the key properties of 2-(benzenesulfonyl)oxane?
2-(benzenesulfonyl)oxane has a molecular weight of 226.30 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)oxane is sourced from PubChem (CID 3707989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).