C12H15N3O3 — CID 3708440
4-(2,4-dimethoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one (PubChem CID 3708440) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 3708440 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2c(C)nn(C)c2=O)c(OC)c1 |
| InChI | InChI=1S/C12H15N3O3/c1-8-13-14(2)12(16)15(8)10-6-5-9(17-3)7-11(10)18-4/h5-7H,1-4H3 |
| InChIKey | DJQDLOVPXMHRMW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |