About methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate
methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate (PubChem CID 3708541) has the molecular formula C13H18Br2N2O5S2
and a molecular weight of 506.24 g/mol. Its IUPAC name is methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate |
| PubChem CID | 3708541 |
| Molecular Formula | C13H18Br2N2O5S2 |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 503.90 |
| IUPAC Name | methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CNS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H18Br2N2O5S2/c1-7(2)4-9(13(19)22-3)17-10(18)6-16-24(20,21)11-5-8(14)12(15)23-11/h5,7,9,16H,4,6H2,1-3H3,(H,17,18) |
| InChIKey | OHMLROZXBRZEKV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate?
The IUPAC name of methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate (CID 3708541) is methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate.
What is the SMILES notation for methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate?
The canonical SMILES for methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate is COC(=O)C(CC(C)C)NC(=O)CNS(=O)(=O)c1cc(Br)c(Br)s1.
What is the InChIKey of methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate?
The InChIKey is OHMLROZXBRZEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Br2N2O5S2/c1-7(2)4-9(13(19)22-3)17-10(18)6-16-24(20,21)11-5-8(14)12(15)23-11/h5,7,9,16H,4,6H2,1-3H3,(H,17,18).
What are the key properties of methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate?
methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate has a molecular weight of 506.24 g/mol, XLogP of 2.26, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetyl]amino]-4-methylpentanoate is sourced from PubChem (CID 3708541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).